C34H35BrN2O2 — CID 15947494
1-(3-bromophenyl)-6-(dimethylamino)-1-(2-methoxyquinolin-3-yl)-2-naphthalen-2-ylhexan-2-ol (PubChem CID 15947494) has the molecular formula C34H35BrN2O2 and a molecular weight of 583.57 g/mol. Its IUPAC name is 1-(3-bromophenyl)-6-(dimethylamino)-1-(2-methoxyquinolin-3-yl)-2-naphthalen-2-ylhexan-2-ol.
| Compound Name | 1-(3-bromophenyl)-6-(dimethylamino)-1-(2-methoxyquinolin-3-yl)-2-naphthalen-2-ylhexan-2-ol |
|---|---|
| PubChem CID | 15947494 |
| Molecular Formula | C34H35BrN2O2 |
| Molecular Weight | 583.57 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | 1-(3-bromophenyl)-6-(dimethylamino)-1-(2-methoxyquinolin-3-yl)-2-naphthalen-2-ylhexan-2-ol |
| SMILES | COc1nc2ccccc2cc1C(c1cccc(Br)c1)C(O)(CCCCN(C)C)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C34H35BrN2O2/c1-37(2)20-9-8-19-34(38,28-18-17-24-11-4-5-12-25(24)21-28)32(27-14-10-15-29(35)22-27)30-23-26-13-6-7-16-31(26)36-33(30)39-3/h4-7,10-18,21-23,32,38H,8-9,19-20H2,1-3H3 |
| InChIKey | YNLAYKSKIAIWLF-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.57 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|