C32H31BN2O2 — CID 88964570
CID 88964570 (PubChem CID 88964570) has the molecular formula C32H31BN2O2 and a molecular weight of 486.42 g/mol.
| Compound Name | CID 88964570 |
|---|---|
| PubChem CID | 88964570 |
| Molecular Formula | C32H31BN2O2 |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2nc(OC)c(C(c3ccccc3)C(O)(CCN(C)C)c3cccc4ccccc34)cc2c1 |
| InChI | InChI=1S/C32H31BN2O2/c1-35(2)19-18-32(36,28-15-9-13-22-10-7-8-14-26(22)28)30(23-11-5-4-6-12-23)27-21-24-20-25(33)16-17-29(24)34-31(27)37-3/h4-17,20-21,30,36H,18-19H2,1-3H3 |
| InChIKey | CVQDYZGWWQVMKN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|