C33H33ClN2O3 — CID 71516168
1-(2-chloro-6,7-dimethoxyquinolin-3-yl)-4-(dimethylamino)-2-naphthalen-1-yl-1-phenylbutan-2-ol (PubChem CID 71516168) has the molecular formula C33H33ClN2O3 and a molecular weight of 541.09 g/mol. Its IUPAC name is 1-(2-chloro-6,7-dimethoxyquinolin-3-yl)-4-(dimethylamino)-2-naphthalen-1-yl-1-phenylbutan-2-ol.
| Compound Name | 1-(2-chloro-6,7-dimethoxyquinolin-3-yl)-4-(dimethylamino)-2-naphthalen-1-yl-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 71516168 |
| Molecular Formula | C33H33ClN2O3 |
| Molecular Weight | 541.09 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | 1-(2-chloro-6,7-dimethoxyquinolin-3-yl)-4-(dimethylamino)-2-naphthalen-1-yl-1-phenylbutan-2-ol |
| SMILES | COc1cc2cc(C(c3ccccc3)C(O)(CCN(C)C)c3cccc4ccccc34)c(Cl)nc2cc1OC |
| InChI | InChI=1S/C33H33ClN2O3/c1-36(2)18-17-33(37,27-16-10-14-22-11-8-9-15-25(22)27)31(23-12-6-5-7-13-23)26-19-24-20-29(38-3)30(39-4)21-28(24)35-32(26)34/h5-16,19-21,31,37H,17-18H2,1-4H3 |
| InChIKey | GWYXJEIJAJGERZ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.09 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|