C28H30N2O2 — CID 118671929
4-(dimethylamino)-1-(2-methoxy-3-pyridinyl)-2-naphthalen-1-yl-1-phenylbutan-2-ol (PubChem CID 118671929) has the molecular formula C28H30N2O2 and a molecular weight of 426.56 g/mol. Its IUPAC name is 4-(dimethylamino)-1-(2-methoxy-3-pyridinyl)-2-naphthalen-1-yl-1-phenylbutan-2-ol.
| Compound Name | 4-(dimethylamino)-1-(2-methoxy-3-pyridinyl)-2-naphthalen-1-yl-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 118671929 |
| Molecular Formula | C28H30N2O2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 4-(dimethylamino)-1-(2-methoxy-3-pyridinyl)-2-naphthalen-1-yl-1-phenylbutan-2-ol |
| SMILES | COc1ncccc1C(c1ccccc1)C(O)(CCN(C)C)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H30N2O2/c1-30(2)20-18-28(31,25-17-9-14-21-11-7-8-15-23(21)25)26(22-12-5-4-6-13-22)24-16-10-19-29-27(24)32-3/h4-17,19,26,31H,18,20H2,1-3H3 |
| InChIKey | SJVFJLKCTIRBSC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |