C30H24BrNO3 — CID 176915260
(3S,4R)-4-(6-bromo-2-methoxyquinolin-3-yl)-3-hydroxy-3-naphthalen-1-yl-4-phenylbutanal (PubChem CID 176915260) has the molecular formula C30H24BrNO3 and a molecular weight of 526.43 g/mol. Its IUPAC name is (3S,4R)-4-(6-bromo-2-methoxyquinolin-3-yl)-3-hydroxy-3-naphthalen-1-yl-4-phenylbutanal.
| Compound Name | (3S,4R)-4-(6-bromo-2-methoxyquinolin-3-yl)-3-hydroxy-3-naphthalen-1-yl-4-phenylbutanal |
|---|---|
| PubChem CID | 176915260 |
| Molecular Formula | C30H24BrNO3 |
| Molecular Weight | 526.43 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | (3S,4R)-4-(6-bromo-2-methoxyquinolin-3-yl)-3-hydroxy-3-naphthalen-1-yl-4-phenylbutanal |
| SMILES | COc1nc2ccc(Br)cc2cc1[C@@H](c1ccccc1)[C@@](O)(CC=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C30H24BrNO3/c1-35-29-25(19-22-18-23(31)14-15-27(22)32-29)28(21-9-3-2-4-10-21)30(34,16-17-33)26-13-7-11-20-8-5-6-12-24(20)26/h2-15,17-19,28,34H,16H2,1H3/t28-,30-/m1/s1 |
| InChIKey | MHWIIPAVZVREPT-PQHLKRTFSA-N |
| XLogP | 6.77 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.43 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|