C33H34BrIN2O2 — CID 15941140
1-(6-bromo-2-methoxyquinolin-3-yl)-2-naphthalen-2-yl-1-phenyl-4-(trimethylazaniumyl)butan-2-olate;hydroiodide (PubChem CID 15941140) has the molecular formula C33H34BrIN2O2 and a molecular weight of 697.46 g/mol. Its IUPAC name is 1-(6-bromo-2-methoxyquinolin-3-yl)-2-naphthalen-2-yl-1-phenyl-4-(trimethylazaniumyl)butan-2-olate;hydroiodide.
| Compound Name | 1-(6-bromo-2-methoxyquinolin-3-yl)-2-naphthalen-2-yl-1-phenyl-4-(trimethylazaniumyl)butan-2-olate;hydroiodide |
|---|---|
| PubChem CID | 15941140 |
| Molecular Formula | C33H34BrIN2O2 |
| Molecular Weight | 697.46 g/mol |
| Exact Mass | 696.08 |
| IUPAC Name | 1-(6-bromo-2-methoxyquinolin-3-yl)-2-naphthalen-2-yl-1-phenyl-4-(trimethylazaniumyl)butan-2-olate;hydroiodide |
| SMILES | COc1nc2ccc(Br)cc2cc1C(c1ccccc1)C([O-])(CC[N+](C)(C)C)c1ccc2ccccc2c1.I |
| InChI | InChI=1S/C33H33BrN2O2.HI/c1-36(2,3)19-18-33(37,27-15-14-23-10-8-9-13-25(23)20-27)31(24-11-6-5-7-12-24)29-22-26-21-28(34)16-17-30(26)35-32(29)38-4;/h5-17,20-22,31H,18-19H2,1-4H3;1H |
| InChIKey | KRPKYJJUBCDEOQ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 45.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.46 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|