C29H25BrN2O — CID 139236694
(1S)-N-[(S)-(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-1-naphthalen-1-ylethanamine (PubChem CID 139236694) has the molecular formula C29H25BrN2O and a molecular weight of 497.44 g/mol. Its IUPAC name is (1S)-N-[(S)-(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-1-naphthalen-1-ylethanamine.
| Compound Name | (1S)-N-[(S)-(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-1-naphthalen-1-ylethanamine |
|---|---|
| PubChem CID | 139236694 |
| Molecular Formula | C29H25BrN2O |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | (1S)-N-[(S)-(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-1-naphthalen-1-ylethanamine |
| SMILES | COc1nc2ccc(Br)cc2cc1[C@@H](N[C@@H](C)c1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C29H25BrN2O/c1-19(24-14-8-12-20-9-6-7-13-25(20)24)31-28(21-10-4-3-5-11-21)26-18-22-17-23(30)15-16-27(22)32-29(26)33-2/h3-19,28,31H,1-2H3/t19-,28-/m0/s1 |
| InChIKey | VXTUQNRWFJKBQY-VKGTZQKMSA-N |
| XLogP | 7.60 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |