C35H42BrN3O2 — CID 118195579
3-[(R)-(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-7-(4-methylpiperazin-1-yl)-1-phenylheptan-3-ol (PubChem CID 118195579) has the molecular formula C35H42BrN3O2 and a molecular weight of 616.64 g/mol. Its IUPAC name is 3-[(R)-(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-7-(4-methylpiperazin-1-yl)-1-phenylheptan-3-ol.
| Compound Name | 3-[(R)-(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-7-(4-methylpiperazin-1-yl)-1-phenylheptan-3-ol |
|---|---|
| PubChem CID | 118195579 |
| Molecular Formula | C35H42BrN3O2 |
| Molecular Weight | 616.64 g/mol |
| Exact Mass | 615.25 |
| IUPAC Name | 3-[(R)-(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-7-(4-methylpiperazin-1-yl)-1-phenylheptan-3-ol |
| SMILES | COc1nc2ccc(Br)cc2cc1[C@@H](c1ccccc1)C(O)(CCCCN1CCN(C)CC1)CCc1ccccc1 |
| InChI | InChI=1S/C35H42BrN3O2/c1-38-21-23-39(24-22-38)20-10-9-18-35(40,19-17-27-11-5-3-6-12-27)33(28-13-7-4-8-14-28)31-26-29-25-30(36)15-16-32(29)37-34(31)41-2/h3-8,11-16,25-26,33,40H,9-10,17-24H2,1-2H3/t33-,35?/m1/s1 |
| InChIKey | YMINFFUVPWQFTH-FFGQRACBSA-N |
| XLogP | 6.92 |
| TPSA | 48.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.64 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|