C30H33ClN2O2 — CID 122576081
3-[(6-chloro-2-ethoxyquinolin-3-yl)-phenylmethyl]-1-(methylamino)-5-phenylpentan-3-ol (PubChem CID 122576081) has the molecular formula C30H33ClN2O2 and a molecular weight of 489.06 g/mol. Its IUPAC name is 3-[(6-chloro-2-ethoxyquinolin-3-yl)-phenylmethyl]-1-(methylamino)-5-phenylpentan-3-ol.
| Compound Name | 3-[(6-chloro-2-ethoxyquinolin-3-yl)-phenylmethyl]-1-(methylamino)-5-phenylpentan-3-ol |
|---|---|
| PubChem CID | 122576081 |
| Molecular Formula | C30H33ClN2O2 |
| Molecular Weight | 489.06 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 3-[(6-chloro-2-ethoxyquinolin-3-yl)-phenylmethyl]-1-(methylamino)-5-phenylpentan-3-ol |
| SMILES | CCOc1nc2ccc(Cl)cc2cc1C(c1ccccc1)C(O)(CCNC)CCc1ccccc1 |
| InChI | InChI=1S/C30H33ClN2O2/c1-3-35-29-26(21-24-20-25(31)14-15-27(24)33-29)28(23-12-8-5-9-13-23)30(34,18-19-32-2)17-16-22-10-6-4-7-11-22/h4-15,20-21,28,32,34H,3,16-19H2,1-2H3 |
| InChIKey | OUOQCAQDUANRTO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.06 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |