C29H27NO3 — CID 118671989
3-benzyl-3-hydroxy-4-(2-methoxy-5-phenyl-3-pyridinyl)-4-phenylbutanal (PubChem CID 118671989) has the molecular formula C29H27NO3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-benzyl-3-hydroxy-4-(2-methoxy-5-phenyl-3-pyridinyl)-4-phenylbutanal.
| Compound Name | 3-benzyl-3-hydroxy-4-(2-methoxy-5-phenyl-3-pyridinyl)-4-phenylbutanal |
|---|---|
| PubChem CID | 118671989 |
| Molecular Formula | C29H27NO3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-benzyl-3-hydroxy-4-(2-methoxy-5-phenyl-3-pyridinyl)-4-phenylbutanal |
| SMILES | COc1ncc(-c2ccccc2)cc1C(c1ccccc1)C(O)(CC=O)Cc1ccccc1 |
| InChI | InChI=1S/C29H27NO3/c1-33-28-26(19-25(21-30-28)23-13-7-3-8-14-23)27(24-15-9-4-10-16-24)29(32,17-18-31)20-22-11-5-2-6-12-22/h2-16,18-19,21,27,32H,17,20H2,1H3 |
| InChIKey | KRBVOSXAJSNZHB-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|