About 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane
4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane (PubChem CID 144997558) has the molecular formula C32H38N2O2
and a molecular weight of 482.67 g/mol. Its IUPAC name is 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane.
Molecular Properties
| Compound Name | 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane |
| PubChem CID | 144997558 |
| Molecular Formula | C32H38N2O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane |
| SMILES | CC.COc1ncc(-c2ccccc2)cc1C(c1ccccc1)C(O)(CCN(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H32N2O2.C2H6/c1-32(2)20-19-30(33,26-17-11-6-12-18-26)28(24-15-9-5-10-16-24)27-21-25(22-31-29(27)34-3)23-13-7-4-8-14-23;1-2/h4-18,21-22,28,33H,19-20H2,1-3H3;1-2H3 |
| InChIKey | GZQKVQJXBIOYDH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane?
The IUPAC name of 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane (CID 144997558) is 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane.
What is the SMILES notation for 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane?
The canonical SMILES for 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane is CC.COc1ncc(-c2ccccc2)cc1C(c1ccccc1)C(O)(CCN(C)C)c1ccccc1.
What is the InChIKey of 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane?
The InChIKey is GZQKVQJXBIOYDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32N2O2.C2H6/c1-32(2)20-19-30(33,26-17-11-6-12-18-26)28(24-15-9-5-10-16-24)27-21-25(22-31-29(27)34-3)23-13-7-4-8-14-23;1-2/h4-18,21-22,28,33H,19-20H2,1-3H3;1-2H3.
What are the key properties of 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane?
4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane has a molecular weight of 482.67 g/mol, XLogP of 6.75, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1,2-diphenylbutan-2-ol;ethane is sourced from PubChem (CID 144997558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).