C29H31BrN2O2 — CID 142854962
1-(7-bromo-2-methoxy-7H-cyclohepta[b]pyridin-3-yl)-4-(dimethylamino)-1,2-diphenylbutan-2-ol (PubChem CID 142854962) has the molecular formula C29H31BrN2O2 and a molecular weight of 519.48 g/mol. Its IUPAC name is 1-(7-bromo-2-methoxy-7H-cyclohepta[b]pyridin-3-yl)-4-(dimethylamino)-1,2-diphenylbutan-2-ol.
| Compound Name | 1-(7-bromo-2-methoxy-7H-cyclohepta[b]pyridin-3-yl)-4-(dimethylamino)-1,2-diphenylbutan-2-ol |
|---|---|
| PubChem CID | 142854962 |
| Molecular Formula | C29H31BrN2O2 |
| Molecular Weight | 519.48 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 1-(7-bromo-2-methoxy-7H-cyclohepta[b]pyridin-3-yl)-4-(dimethylamino)-1,2-diphenylbutan-2-ol |
| SMILES | COc1nc2c(cc1C(c1ccccc1)C(O)(CCN(C)C)c1ccccc1)C=CC(Br)C=C2 |
| InChI | InChI=1S/C29H31BrN2O2/c1-32(2)19-18-29(33,23-12-8-5-9-13-23)27(21-10-6-4-7-11-21)25-20-22-14-15-24(30)16-17-26(22)31-28(25)34-3/h4-17,20,24,27,33H,18-19H2,1-3H3 |
| InChIKey | UUQDCTYJFDUTOC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.48 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|