C31H34N2O2 — CID 118671848
2-benzyl-4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1-phenylbutan-2-ol (PubChem CID 118671848) has the molecular formula C31H34N2O2 and a molecular weight of 466.63 g/mol. Its IUPAC name is 2-benzyl-4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1-phenylbutan-2-ol.
| Compound Name | 2-benzyl-4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1-phenylbutan-2-ol |
|---|---|
| PubChem CID | 118671848 |
| Molecular Formula | C31H34N2O2 |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 2-benzyl-4-(dimethylamino)-1-(2-methoxy-5-phenyl-3-pyridinyl)-1-phenylbutan-2-ol |
| SMILES | COc1ncc(-c2ccccc2)cc1C(c1ccccc1)C(O)(CCN(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C31H34N2O2/c1-33(2)20-19-31(34,22-24-13-7-4-8-14-24)29(26-17-11-6-12-18-26)28-21-27(23-32-30(28)35-3)25-15-9-5-10-16-25/h4-18,21,23,29,34H,19-20,22H2,1-3H3 |
| InChIKey | VGZXSOYMXCHKPY-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |