C35H40N2O2 — CID 24988089
1-(6-ethenyl-2-methoxyquinolin-3-yl)-1,2-diphenyl-6-piperidin-1-ylhexan-2-ol (PubChem CID 24988089) has the molecular formula C35H40N2O2 and a molecular weight of 520.72 g/mol. Its IUPAC name is 1-(6-ethenyl-2-methoxyquinolin-3-yl)-1,2-diphenyl-6-piperidin-1-ylhexan-2-ol.
| Compound Name | 1-(6-ethenyl-2-methoxyquinolin-3-yl)-1,2-diphenyl-6-piperidin-1-ylhexan-2-ol |
|---|---|
| PubChem CID | 24988089 |
| Molecular Formula | C35H40N2O2 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | 1-(6-ethenyl-2-methoxyquinolin-3-yl)-1,2-diphenyl-6-piperidin-1-ylhexan-2-ol |
| SMILES | C=Cc1ccc2nc(OC)c(C(c3ccccc3)C(O)(CCCCN3CCCCC3)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C35H40N2O2/c1-3-27-19-20-32-29(25-27)26-31(34(36-32)39-2)33(28-15-7-4-8-16-28)35(38,30-17-9-5-10-18-30)21-11-14-24-37-22-12-6-13-23-37/h3-5,7-10,15-20,25-26,33,38H,1,6,11-14,21-24H2,2H3 |
| InChIKey | MPQWCMBDWHYVQJ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|