C33H35BrCl2N2O2 — CID 15947496
1-(6-bromo-2-methoxyquinolin-3-yl)-1-(3,4-dichlorophenyl)-2-phenyl-6-piperidin-1-ylhexan-2-ol (PubChem CID 15947496) has the molecular formula C33H35BrCl2N2O2 and a molecular weight of 642.47 g/mol. Its IUPAC name is 1-(6-bromo-2-methoxyquinolin-3-yl)-1-(3,4-dichlorophenyl)-2-phenyl-6-piperidin-1-ylhexan-2-ol.
| Compound Name | 1-(6-bromo-2-methoxyquinolin-3-yl)-1-(3,4-dichlorophenyl)-2-phenyl-6-piperidin-1-ylhexan-2-ol |
|---|---|
| PubChem CID | 15947496 |
| Molecular Formula | C33H35BrCl2N2O2 |
| Molecular Weight | 642.47 g/mol |
| Exact Mass | 640.13 |
| IUPAC Name | 1-(6-bromo-2-methoxyquinolin-3-yl)-1-(3,4-dichlorophenyl)-2-phenyl-6-piperidin-1-ylhexan-2-ol |
| SMILES | COc1nc2ccc(Br)cc2cc1C(c1ccc(Cl)c(Cl)c1)C(O)(CCCCN1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C33H35BrCl2N2O2/c1-40-32-27(21-24-20-26(34)13-15-30(24)37-32)31(23-12-14-28(35)29(36)22-23)33(39,25-10-4-2-5-11-25)16-6-9-19-38-17-7-3-8-18-38/h2,4-5,10-15,20-22,31,39H,3,6-9,16-19H2,1H3 |
| InChIKey | SKRYJHIJYJZGAM-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.47 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|