C44H27N3OS2 — CID 141303198
4-(1-benzofuran-2-yl)-3,3-bis(1-benzothiophen-2-yl)-2-(1H-indol-2-yl)-5-(1H-pyrrol-2-yl)indole (PubChem CID 141303198) has the molecular formula C44H27N3OS2 and a molecular weight of 677.85 g/mol. Its IUPAC name is 4-(1-benzofuran-2-yl)-3,3-bis(1-benzothiophen-2-yl)-2-(1H-indol-2-yl)-5-(1H-pyrrol-2-yl)indole.
| Compound Name | 4-(1-benzofuran-2-yl)-3,3-bis(1-benzothiophen-2-yl)-2-(1H-indol-2-yl)-5-(1H-pyrrol-2-yl)indole |
|---|---|
| PubChem CID | 141303198 |
| Molecular Formula | C44H27N3OS2 |
| Molecular Weight | 677.85 g/mol |
| Exact Mass | 677.16 |
| IUPAC Name | 4-(1-benzofuran-2-yl)-3,3-bis(1-benzothiophen-2-yl)-2-(1H-indol-2-yl)-5-(1H-pyrrol-2-yl)indole |
| SMILES | c1c[nH]c(-c2ccc3c(c2-c2cc4ccccc4o2)C(c2cc4ccccc4s2)(c2cc4ccccc4s2)C(c2cc4ccccc4[nH]2)=N3)c1 |
| InChI | InChI=1S/C44H27N3OS2/c1-5-14-31-26(10-1)22-34(46-31)43-44(39-24-28-12-3-7-17-37(28)49-39,40-25-29-13-4-8-18-38(29)50-40)42-33(47-43)20-19-30(32-15-9-21-45-32)41(42)36-23-27-11-2-6-16-35(27)48-36/h1-25,45-46H |
| InChIKey | SNHAOHHVXJNNCW-UHFFFAOYSA-N |
| XLogP | 12.47 |
| TPSA | 57.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.85 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |