C22H16O3 — CID 141303776
2-[(4-methoxyphenyl)methylidene]-4-naphthalen-1-ylbut-3-ynoic acid (PubChem CID 141303776) has the molecular formula C22H16O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylidene]-4-naphthalen-1-ylbut-3-ynoic acid.
| Compound Name | 2-[(4-methoxyphenyl)methylidene]-4-naphthalen-1-ylbut-3-ynoic acid |
|---|---|
| PubChem CID | 141303776 |
| Molecular Formula | C22H16O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylidene]-4-naphthalen-1-ylbut-3-ynoic acid |
| SMILES | COc1ccc(C=C(C#Cc2cccc3ccccc23)C(=O)O)cc1 |
| InChI | InChI=1S/C22H16O3/c1-25-20-13-9-16(10-14-20)15-19(22(23)24)12-11-18-7-4-6-17-5-2-3-8-21(17)18/h2-10,13-15H,1H3,(H,23,24) |
| InChIKey | LADMBYBEGXEUNS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|