C15H17Cl3O2 — CID 141304142
2-(2-ethylcyclobutyl)ethyl 2,3,5-trichlorobenzoate (PubChem CID 141304142) has the molecular formula C15H17Cl3O2 and a molecular weight of 335.66 g/mol. Its IUPAC name is 2-(2-ethylcyclobutyl)ethyl 2,3,5-trichlorobenzoate.
| Compound Name | 2-(2-ethylcyclobutyl)ethyl 2,3,5-trichlorobenzoate |
|---|---|
| PubChem CID | 141304142 |
| Molecular Formula | C15H17Cl3O2 |
| Molecular Weight | 335.66 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 2-(2-ethylcyclobutyl)ethyl 2,3,5-trichlorobenzoate |
| SMILES | CCC1CCC1CCOC(=O)c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C15H17Cl3O2/c1-2-9-3-4-10(9)5-6-20-15(19)12-7-11(16)8-13(17)14(12)18/h7-10H,2-6H2,1H3 |
| InChIKey | VIIZXJMVSYSKAQ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.66 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|