C17H21BrN4O — CID 141304935
5-bromo-3-[(4-methoxyphenyl)methyl]-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrazin-2-amine (PubChem CID 141304935) has the molecular formula C17H21BrN4O and a molecular weight of 377.29 g/mol. Its IUPAC name is 5-bromo-3-[(4-methoxyphenyl)methyl]-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrazin-2-amine.
| Compound Name | 5-bromo-3-[(4-methoxyphenyl)methyl]-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 141304935 |
| Molecular Formula | C17H21BrN4O |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 5-bromo-3-[(4-methoxyphenyl)methyl]-N-[[(2S)-pyrrolidin-2-yl]methyl]pyrazin-2-amine |
| SMILES | COc1ccc(Cc2nc(Br)cnc2NC[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C17H21BrN4O/c1-23-14-6-4-12(5-7-14)9-15-17(21-11-16(18)22-15)20-10-13-3-2-8-19-13/h4-7,11,13,19H,2-3,8-10H2,1H3,(H,20,21)/t13-/m0/s1 |
| InChIKey | DPGSVVYYHMPPQQ-ZDUSSCGKSA-N |
| XLogP | 3.00 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |