C20H14N4OS — CID 141307333
4-(furan-2-yl)-2-(1H-pyrazol-5-yl)-3-(1H-pyrrol-2-yl)-5-thiophen-2-ylpyridine (PubChem CID 141307333) has the molecular formula C20H14N4OS and a molecular weight of 358.43 g/mol. Its IUPAC name is 4-(furan-2-yl)-2-(1H-pyrazol-5-yl)-3-(1H-pyrrol-2-yl)-5-thiophen-2-ylpyridine.
| Compound Name | 4-(furan-2-yl)-2-(1H-pyrazol-5-yl)-3-(1H-pyrrol-2-yl)-5-thiophen-2-ylpyridine |
|---|---|
| PubChem CID | 141307333 |
| Molecular Formula | C20H14N4OS |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 4-(furan-2-yl)-2-(1H-pyrazol-5-yl)-3-(1H-pyrrol-2-yl)-5-thiophen-2-ylpyridine |
| SMILES | c1c[nH]c(-c2c(-c3ccn[nH]3)ncc(-c3cccs3)c2-c2ccco2)c1 |
| InChI | InChI=1S/C20H14N4OS/c1-4-14(21-8-1)19-18(16-5-2-10-25-16)13(17-6-3-11-26-17)12-22-20(19)15-7-9-23-24-15/h1-12,21H,(H,23,24) |
| InChIKey | WDXOKEMJABYTAW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |