C25H26F3N3OS — CID 153445671
2-(4,5-dimethylfuran-3-yl)-4-(3-hexylthiophen-2-yl)-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 153445671) has the molecular formula C25H26F3N3OS and a molecular weight of 473.56 g/mol. Its IUPAC name is 2-(4,5-dimethylfuran-3-yl)-4-(3-hexylthiophen-2-yl)-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
| Compound Name | 2-(4,5-dimethylfuran-3-yl)-4-(3-hexylthiophen-2-yl)-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
|---|---|
| PubChem CID | 153445671 |
| Molecular Formula | C25H26F3N3OS |
| Molecular Weight | 473.56 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-(4,5-dimethylfuran-3-yl)-4-(3-hexylthiophen-2-yl)-6-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CCCCCCc1ccsc1-c1cc(-c2cc(C(F)(F)F)[nH]n2)nc(-c2coc(C)c2C)c1 |
| InChI | InChI=1S/C25H26F3N3OS/c1-4-5-6-7-8-17-9-10-33-24(17)18-11-20(19-14-32-16(3)15(19)2)29-21(12-18)22-13-23(31-30-22)25(26,27)28/h9-14H,4-8H2,1-3H3,(H,30,31) |
| InChIKey | ZSGFXCWBLGLZIM-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.56 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|