C8H17N3O4 — CID 141307430
1-[1-(2-azidoethoxy)ethoxy]-2-ethoxyethanol (PubChem CID 141307430) has the molecular formula C8H17N3O4 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-[1-(2-azidoethoxy)ethoxy]-2-ethoxyethanol.
| Compound Name | 1-[1-(2-azidoethoxy)ethoxy]-2-ethoxyethanol |
|---|---|
| PubChem CID | 141307430 |
| Molecular Formula | C8H17N3O4 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 1-[1-(2-azidoethoxy)ethoxy]-2-ethoxyethanol |
| SMILES | CCOCC(O)OC(C)OCCN=[N+]=[N-] |
| InChI | InChI=1S/C8H17N3O4/c1-3-13-6-8(12)15-7(2)14-5-4-10-11-9/h7-8,12H,3-6H2,1-2H3 |
| InChIKey | ANBGSRNLNHVCSI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 96.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|