C16H11FN4OS — CID 141307816
3-fluoro-4-[(2-thiophen-3-yl-1H-imidazo[4,5-b]pyridin-7-yl)oxy]aniline (PubChem CID 141307816) has the molecular formula C16H11FN4OS and a molecular weight of 326.36 g/mol. Its IUPAC name is 3-fluoro-4-[(2-thiophen-3-yl-1H-imidazo[4,5-b]pyridin-7-yl)oxy]aniline.
| Compound Name | 3-fluoro-4-[(2-thiophen-3-yl-1H-imidazo[4,5-b]pyridin-7-yl)oxy]aniline |
|---|---|
| PubChem CID | 141307816 |
| Molecular Formula | C16H11FN4OS |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 3-fluoro-4-[(2-thiophen-3-yl-1H-imidazo[4,5-b]pyridin-7-yl)oxy]aniline |
| SMILES | Nc1ccc(Oc2ccnc3nc(-c4ccsc4)[nH]c23)c(F)c1 |
| InChI | InChI=1S/C16H11FN4OS/c17-11-7-10(18)1-2-12(11)22-13-3-5-19-16-14(13)20-15(21-16)9-4-6-23-8-9/h1-8H,18H2,(H,19,20,21) |
| InChIKey | JLKPSCXBZKGYAP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|