C13H24O5Si — CID 141307920
6-triethoxysilylhept-1-ene-3,4-dione (PubChem CID 141307920) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is 6-triethoxysilylhept-1-ene-3,4-dione.
| Compound Name | 6-triethoxysilylhept-1-ene-3,4-dione |
|---|---|
| PubChem CID | 141307920 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 6-triethoxysilylhept-1-ene-3,4-dione |
| SMILES | C=CC(=O)C(=O)CC(C)[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C13H24O5Si/c1-6-12(14)13(15)10-11(5)19(16-7-2,17-8-3)18-9-4/h6,11H,1,7-10H2,2-5H3 |
| InChIKey | GRDUJDPRLFWLDP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|