C12H22O4Si — CID 141307925
6-[diethoxy(methyl)silyl]hept-1-ene-3,4-dione (PubChem CID 141307925) has the molecular formula C12H22O4Si and a molecular weight of 258.39 g/mol. Its IUPAC name is 6-[diethoxy(methyl)silyl]hept-1-ene-3,4-dione.
| Compound Name | 6-[diethoxy(methyl)silyl]hept-1-ene-3,4-dione |
|---|---|
| PubChem CID | 141307925 |
| Molecular Formula | C12H22O4Si |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 6-[diethoxy(methyl)silyl]hept-1-ene-3,4-dione |
| SMILES | C=CC(=O)C(=O)CC(C)[Si](C)(OCC)OCC |
| InChI | InChI=1S/C12H22O4Si/c1-6-11(13)12(14)9-10(4)17(5,15-7-2)16-8-3/h6,10H,1,7-9H2,2-5H3 |
| InChIKey | GOVJVPFCFLVYOB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|