C24H30ClNO4 — CID 141308833
3-[2-(3-chlorophenyl)ethoxy]-N-cycloheptyl-4-(2-hydroxyethoxy)benzamide (PubChem CID 141308833) has the molecular formula C24H30ClNO4 and a molecular weight of 431.96 g/mol. Its IUPAC name is 3-[2-(3-chlorophenyl)ethoxy]-N-cycloheptyl-4-(2-hydroxyethoxy)benzamide.
| Compound Name | 3-[2-(3-chlorophenyl)ethoxy]-N-cycloheptyl-4-(2-hydroxyethoxy)benzamide |
|---|---|
| PubChem CID | 141308833 |
| Molecular Formula | C24H30ClNO4 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 3-[2-(3-chlorophenyl)ethoxy]-N-cycloheptyl-4-(2-hydroxyethoxy)benzamide |
| SMILES | O=C(NC1CCCCCC1)c1ccc(OCCO)c(OCCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C24H30ClNO4/c25-20-7-5-6-18(16-20)12-14-29-23-17-19(10-11-22(23)30-15-13-27)24(28)26-21-8-3-1-2-4-9-21/h5-7,10-11,16-17,21,27H,1-4,8-9,12-15H2,(H,26,28) |
| InChIKey | ZIDSDHAODBMKBU-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |