About [(E)-hex-1-enyl] trifluoromethanesulfonate
[(E)-hex-1-enyl] trifluoromethanesulfonate (PubChem CID 141309403) has the molecular formula C7H11F3O3S
and a molecular weight of 232.22 g/mol. Its IUPAC name is [(E)-hex-1-enyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(E)-hex-1-enyl] trifluoromethanesulfonate |
| PubChem CID | 141309403 |
| Molecular Formula | C7H11F3O3S |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | [(E)-hex-1-enyl] trifluoromethanesulfonate |
| SMILES | CCCC/C=C/OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3O3S/c1-2-3-4-5-6-13-14(11,12)7(8,9)10/h5-6H,2-4H2,1H3/b6-5+ |
| InChIKey | BDDUAVXYUPZBHM-AATRIKPKSA-N |
| XLogP | 2.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(E)-hex-1-enyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-hex-1-enyl] trifluoromethanesulfonate?
The IUPAC name of [(E)-hex-1-enyl] trifluoromethanesulfonate (CID 141309403) is [(E)-hex-1-enyl] trifluoromethanesulfonate.
What is the SMILES notation for [(E)-hex-1-enyl] trifluoromethanesulfonate?
The canonical SMILES for [(E)-hex-1-enyl] trifluoromethanesulfonate is CCCC/C=C/OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [(E)-hex-1-enyl] trifluoromethanesulfonate?
The InChIKey is BDDUAVXYUPZBHM-AATRIKPKSA-N. The full InChI is InChI=1S/C7H11F3O3S/c1-2-3-4-5-6-13-14(11,12)7(8,9)10/h5-6H,2-4H2,1H3/b6-5+.
What are the key properties of [(E)-hex-1-enyl] trifluoromethanesulfonate?
[(E)-hex-1-enyl] trifluoromethanesulfonate has a molecular weight of 232.22 g/mol, XLogP of 2.56, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-hex-1-enyl] trifluoromethanesulfonate is sourced from PubChem (CID 141309403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).