C11H10Br3NO3 — CID 141311419
(4S,5R)-4-phenyl-2-(tribromomethyl)-1,3-oxazolidine-5-carboxylic acid (PubChem CID 141311419) has the molecular formula C11H10Br3NO3 and a molecular weight of 443.92 g/mol. Its IUPAC name is (4S,5R)-4-phenyl-2-(tribromomethyl)-1,3-oxazolidine-5-carboxylic acid.
| Compound Name | (4S,5R)-4-phenyl-2-(tribromomethyl)-1,3-oxazolidine-5-carboxylic acid |
|---|---|
| PubChem CID | 141311419 |
| Molecular Formula | C11H10Br3NO3 |
| Molecular Weight | 443.92 g/mol |
| Exact Mass | 440.82 |
| IUPAC Name | (4S,5R)-4-phenyl-2-(tribromomethyl)-1,3-oxazolidine-5-carboxylic acid |
| SMILES | O=C(O)[C@@H]1OC(C(Br)(Br)Br)N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H10Br3NO3/c12-11(13,14)10-15-7(8(18-10)9(16)17)6-4-2-1-3-5-6/h1-5,7-8,10,15H,(H,16,17)/t7-,8+,10?/m0/s1 |
| InChIKey | XDWPLPSEIYVHFO-VLCSVPMDSA-N |
| XLogP | 2.97 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.92 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|