C15H18N4O3 — CID 141312482
4-[2-[(3R)-oxolan-3-yl]oxypyrido[2,3-d]pyrimidin-4-yl]morpholine (PubChem CID 141312482) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is 4-[2-[(3R)-oxolan-3-yl]oxypyrido[2,3-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-[(3R)-oxolan-3-yl]oxypyrido[2,3-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 141312482 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 4-[2-[(3R)-oxolan-3-yl]oxypyrido[2,3-d]pyrimidin-4-yl]morpholine |
| SMILES | c1cnc2nc(O[C@@H]3CCOC3)nc(N3CCOCC3)c2c1 |
| InChI | InChI=1S/C15H18N4O3/c1-2-12-13(16-4-1)17-15(22-11-3-7-21-10-11)18-14(12)19-5-8-20-9-6-19/h1-2,4,11H,3,5-10H2/t11-/m1/s1 |
| InChIKey | PCMVBQOBEWUJTK-LLVKDONJSA-N |
| XLogP | 1.03 |
| TPSA | 69.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |