C16H21N7O2 — CID 46202650
5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)pyridin-2-amine (PubChem CID 46202650) has the molecular formula C16H21N7O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)pyridin-2-amine.
| Compound Name | 5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 46202650 |
| Molecular Formula | C16H21N7O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 5-(4,6-dimorpholin-4-yl-1,3,5-triazin-2-yl)pyridin-2-amine |
| SMILES | Nc1ccc(-c2nc(N3CCOCC3)nc(N3CCOCC3)n2)cn1 |
| InChI | InChI=1S/C16H21N7O2/c17-13-2-1-12(11-18-13)14-19-15(22-3-7-24-8-4-22)21-16(20-14)23-5-9-25-10-6-23/h1-2,11H,3-10H2,(H2,17,18) |
| InChIKey | CCDWKOPCDXYXLL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 102.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |