C13H17N3O2 — CID 141312567
(5S)-3-pyridin-3-yl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one (PubChem CID 141312567) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is (5S)-3-pyridin-3-yl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one.
| Compound Name | (5S)-3-pyridin-3-yl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
|---|---|
| PubChem CID | 141312567 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | (5S)-3-pyridin-3-yl-1-oxa-3,9-diazaspiro[4.6]undecan-2-one |
| SMILES | O=C1O[C@]2(CCCNCC2)CN1c1cccnc1 |
| InChI | InChI=1S/C13H17N3O2/c17-12-16(11-3-1-6-15-9-11)10-13(18-12)4-2-7-14-8-5-13/h1,3,6,9,14H,2,4-5,7-8,10H2/t13-/m0/s1 |
| InChIKey | VXIXVZVQZHRGGW-ZDUSSCGKSA-N |
| XLogP | 1.55 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |