About tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate
tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate (PubChem CID 141313911) has the molecular formula C10H14F3NO2
and a molecular weight of 237.22 g/mol. Its IUPAC name is tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate.
Analyze tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate?
The IUPAC name of tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate (CID 141313911) is tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate.
What is the SMILES notation for tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate?
The canonical SMILES for tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate is CC(C)(C)OC(=O)C1(C(F)(F)F)CCC=N1.
What is the InChIKey of tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate?
The InChIKey is NLPRMWBMKZROGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3NO2/c1-8(2,3)16-7(15)9(10(11,12)13)5-4-6-14-9/h6H,4-5H2,1-3H3.
What are the key properties of tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate?
tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate has a molecular weight of 237.22 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(trifluoromethyl)-3,4-dihydropyrrole-2-carboxylate is sourced from PubChem (CID 141313911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).