C10H18NO3+ — CID 6395410
tert-butyl 1-hydroxy-2-methyl-3,4-dihydropyrrol-1-ium-2-carboxylate (PubChem CID 6395410) has the molecular formula C10H18NO3+ and a molecular weight of 200.26 g/mol. Its IUPAC name is tert-butyl 1-hydroxy-2-methyl-3,4-dihydropyrrol-1-ium-2-carboxylate.
| Compound Name | tert-butyl 1-hydroxy-2-methyl-3,4-dihydropyrrol-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 6395410 |
| Molecular Formula | C10H18NO3+ |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | tert-butyl 1-hydroxy-2-methyl-3,4-dihydropyrrol-1-ium-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C)CCC=[N+]1O |
| InChI | InChI=1S/C10H18NO3/c1-9(2,3)14-8(12)10(4)6-5-7-11(10)13/h7,13H,5-6H2,1-4H3/q+1 |
| InChIKey | COKOKVAKWLMYGD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|