C16H18N2O2 — CID 141314967
2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)benzene-1,3-dicarboxamide (PubChem CID 141314967) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)benzene-1,3-dicarboxamide.
| Compound Name | 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 141314967 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-(1,6-dimethylcyclohexa-2,4-dien-1-yl)benzene-1,3-dicarboxamide |
| SMILES | CC1C=CC=CC1(C)c1c(C(N)=O)cccc1C(N)=O |
| InChI | InChI=1S/C16H18N2O2/c1-10-6-3-4-9-16(10,2)13-11(14(17)19)7-5-8-12(13)15(18)20/h3-10H,1-2H3,(H2,17,19)(H2,18,20) |
| InChIKey | XVZNXBNFLYBYDR-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |