About diazanium;propan-2-olate;chloride
diazanium;propan-2-olate;chloride (PubChem CID 141314970) has the molecular formula C3H15ClN2O
and a molecular weight of 130.62 g/mol. Its IUPAC name is diazanium;propan-2-olate;chloride.
Molecular Properties
| Compound Name | diazanium;propan-2-olate;chloride |
| PubChem CID | 141314970 |
| Molecular Formula | C3H15ClN2O |
| Molecular Weight | 130.62 g/mol |
| Exact Mass | 130.09 |
| IUPAC Name | diazanium;propan-2-olate;chloride |
| SMILES | CC(C)[O-].[Cl-].[NH4+].[NH4+] |
| InChI | InChI=1S/C3H7O.ClH.2H3N/c1-3(2)4;;;/h3H,1-2H3;1H;2*1H3/q-1;;;/p+1 |
| InChIKey | SKQYZVYUCVVXGS-UHFFFAOYSA-O |
| XLogP | -2.49 |
| TPSA | 96.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.62 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diazanium;propan-2-olate;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazanium;propan-2-olate;chloride?
The IUPAC name of diazanium;propan-2-olate;chloride (CID 141314970) is diazanium;propan-2-olate;chloride.
What is the SMILES notation for diazanium;propan-2-olate;chloride?
The canonical SMILES for diazanium;propan-2-olate;chloride is CC(C)[O-].[Cl-].[NH4+].[NH4+].
What is the InChIKey of diazanium;propan-2-olate;chloride?
The InChIKey is SKQYZVYUCVVXGS-UHFFFAOYSA-O. The full InChI is InChI=1S/C3H7O.ClH.2H3N/c1-3(2)4;;;/h3H,1-2H3;1H;2*1H3/q-1;;;/p+1.
What are the key properties of diazanium;propan-2-olate;chloride?
diazanium;propan-2-olate;chloride has a molecular weight of 130.62 g/mol, XLogP of -2.49, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diazanium;propan-2-olate;chloride is sourced from PubChem (CID 141314970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).