About [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone
[6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone (PubChem CID 141316031) has the molecular formula C13H18N4O3S
and a molecular weight of 310.38 g/mol. Its IUPAC name is [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone.
Molecular Properties
| Compound Name | [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone |
| PubChem CID | 141316031 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1ccc(N2CCCS2(=O)=O)nc1)N1CCNCC1 |
| InChI | InChI=1S/C13H18N4O3S/c18-13(16-7-4-14-5-8-16)11-2-3-12(15-10-11)17-6-1-9-21(17,19)20/h2-3,10,14H,1,4-9H2 |
| InChIKey | LZMCGIIVTGCAKD-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone?
The IUPAC name of [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone (CID 141316031) is [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone.
What is the SMILES notation for [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone?
The canonical SMILES for [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone is O=C(c1ccc(N2CCCS2(=O)=O)nc1)N1CCNCC1.
What is the InChIKey of [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone?
The InChIKey is LZMCGIIVTGCAKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O3S/c18-13(16-7-4-14-5-8-16)11-2-3-12(15-10-11)17-6-1-9-21(17,19)20/h2-3,10,14H,1,4-9H2.
What are the key properties of [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone?
[6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone has a molecular weight of 310.38 g/mol, XLogP of -0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-pyridinyl]-piperazin-1-ylmethanone is sourced from PubChem (CID 141316031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).