C16H13FN2O2S — CID 141316517
7-(4-amino-2-fluorophenyl)-3-ethylthieno[3,2-b]pyridine-2-carboxylic acid (PubChem CID 141316517) has the molecular formula C16H13FN2O2S and a molecular weight of 316.36 g/mol. Its IUPAC name is 7-(4-amino-2-fluorophenyl)-3-ethylthieno[3,2-b]pyridine-2-carboxylic acid.
| Compound Name | 7-(4-amino-2-fluorophenyl)-3-ethylthieno[3,2-b]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 141316517 |
| Molecular Formula | C16H13FN2O2S |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 7-(4-amino-2-fluorophenyl)-3-ethylthieno[3,2-b]pyridine-2-carboxylic acid |
| SMILES | CCc1c(C(=O)O)sc2c(-c3ccc(N)cc3F)ccnc12 |
| InChI | InChI=1S/C16H13FN2O2S/c1-2-9-13-14(22-15(9)16(20)21)11(5-6-19-13)10-4-3-8(18)7-12(10)17/h3-7H,2,18H2,1H3,(H,20,21) |
| InChIKey | JNWNBNPNYGDRGG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|