C9H13F6NO4 — CID 141317699
1,1,2,4,4,4-hexafluorobutyl 2-[(dihydroxyamino)methyl]butanoate (PubChem CID 141317699) has the molecular formula C9H13F6NO4 and a molecular weight of 313.19 g/mol. Its IUPAC name is 1,1,2,4,4,4-hexafluorobutyl 2-[(dihydroxyamino)methyl]butanoate.
| Compound Name | 1,1,2,4,4,4-hexafluorobutyl 2-[(dihydroxyamino)methyl]butanoate |
|---|---|
| PubChem CID | 141317699 |
| Molecular Formula | C9H13F6NO4 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 1,1,2,4,4,4-hexafluorobutyl 2-[(dihydroxyamino)methyl]butanoate |
| SMILES | CCC(CN(O)O)C(=O)OC(F)(F)C(F)CC(F)(F)F |
| InChI | InChI=1S/C9H13F6NO4/c1-2-5(4-16(18)19)7(17)20-9(14,15)6(10)3-8(11,12)13/h5-6,18-19H,2-4H2,1H3 |
| InChIKey | LEMFDMVINIVCKS-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|