C19H16Cl2N4O3 — CID 141318014
4-(2,7-dichloro-1-phenylpyrrolo[2,3-c]pyridine-3-carbonyl)piperazine-1-carboxylic acid (PubChem CID 141318014) has the molecular formula C19H16Cl2N4O3 and a molecular weight of 419.27 g/mol. Its IUPAC name is 4-(2,7-dichloro-1-phenylpyrrolo[2,3-c]pyridine-3-carbonyl)piperazine-1-carboxylic acid.
| Compound Name | 4-(2,7-dichloro-1-phenylpyrrolo[2,3-c]pyridine-3-carbonyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 141318014 |
| Molecular Formula | C19H16Cl2N4O3 |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 4-(2,7-dichloro-1-phenylpyrrolo[2,3-c]pyridine-3-carbonyl)piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(C(=O)c2c(Cl)n(-c3ccccc3)c3c(Cl)nccc23)CC1 |
| InChI | InChI=1S/C19H16Cl2N4O3/c20-16-15-13(6-7-22-16)14(17(21)25(15)12-4-2-1-3-5-12)18(26)23-8-10-24(11-9-23)19(27)28/h1-7H,8-11H2,(H,27,28) |
| InChIKey | QBBCKCIZTNBXML-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|