C24H25ClN8O2 — CID 87318755
4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylic acid (PubChem CID 87318755) has the molecular formula C24H25ClN8O2 and a molecular weight of 492.97 g/mol. Its IUPAC name is 4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87318755 |
| Molecular Formula | C24H25ClN8O2 |
| Molecular Weight | 492.97 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 4-[6-[(10-chloro-8-cyclopentyl-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2ccc(Nc3ncc4c5ccnc(Cl)c5n(C5CCCC5)c4n3)nc2)CC1 |
| InChI | InChI=1S/C24H25ClN8O2/c25-21-20-17(7-8-26-21)18-14-28-23(30-22(18)33(20)15-3-1-2-4-15)29-19-6-5-16(13-27-19)31-9-11-32(12-10-31)24(34)35/h5-8,13-15H,1-4,9-12H2,(H,34,35)(H,27,28,29,30) |
| InChIKey | LBUMNYBERNGUKA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.97 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|