C31H43ClN8OSi — CID 88936533
10-chloro-8-cyclopentyl-N-[5-[4-[4-[hydroxy(dimethyl)silyl]-4-methylpentyl]piperazin-1-yl]-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 88936533) has the molecular formula C31H43ClN8OSi and a molecular weight of 607.28 g/mol. Its IUPAC name is 10-chloro-8-cyclopentyl-N-[5-[4-[4-[hydroxy(dimethyl)silyl]-4-methylpentyl]piperazin-1-yl]-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 10-chloro-8-cyclopentyl-N-[5-[4-[4-[hydroxy(dimethyl)silyl]-4-methylpentyl]piperazin-1-yl]-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 88936533 |
| Molecular Formula | C31H43ClN8OSi |
| Molecular Weight | 607.28 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | 10-chloro-8-cyclopentyl-N-[5-[4-[4-[hydroxy(dimethyl)silyl]-4-methylpentyl]piperazin-1-yl]-2-pyridinyl]-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | CC(C)(CCCN1CCN(c2ccc(Nc3ncc4c5ccnc(Cl)c5n(C5CCCC5)c4n3)nc2)CC1)[Si](C)(C)O |
| InChI | InChI=1S/C31H43ClN8OSi/c1-31(2,42(3,4)41)13-7-15-38-16-18-39(19-17-38)23-10-11-26(34-20-23)36-30-35-21-25-24-12-14-33-28(32)27(24)40(29(25)37-30)22-8-5-6-9-22/h10-12,14,20-22,41H,5-9,13,15-19H2,1-4H3,(H,34,35,36,37) |
| InChIKey | IBKGRMCXXYJZOC-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.28 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|