C26H28FN7O2 — CID 58299865
2-[1-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperidin-4-yl]acetic acid (PubChem CID 58299865) has the molecular formula C26H28FN7O2 and a molecular weight of 489.56 g/mol. Its IUPAC name is 2-[1-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 58299865 |
| Molecular Formula | C26H28FN7O2 |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 2-[1-[6-[(8-cyclopentyl-10-fluoro-4,6,8,11-tetrazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-yl)amino]-3-pyridinyl]piperidin-4-yl]acetic acid |
| SMILES | O=C(O)CC1CCN(c2ccc(Nc3ncc4c5ccnc(F)c5n(C5CCCC5)c4n3)nc2)CC1 |
| InChI | InChI=1S/C26H28FN7O2/c27-24-23-19(7-10-28-24)20-15-30-26(32-25(20)34(23)17-3-1-2-4-17)31-21-6-5-18(14-29-21)33-11-8-16(9-12-33)13-22(35)36/h5-7,10,14-17H,1-4,8-9,11-13H2,(H,35,36)(H,29,30,31,32) |
| InChIKey | RCNCBHMVHBVWQD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|