C19H21NO — CID 141318106
2-[3-[2-(3-propoxyphenyl)ethyl]phenyl]acetonitrile (PubChem CID 141318106) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 2-[3-[2-(3-propoxyphenyl)ethyl]phenyl]acetonitrile.
| Compound Name | 2-[3-[2-(3-propoxyphenyl)ethyl]phenyl]acetonitrile |
|---|---|
| PubChem CID | 141318106 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 2-[3-[2-(3-propoxyphenyl)ethyl]phenyl]acetonitrile |
| SMILES | CCCOc1cccc(CCc2cccc(CC#N)c2)c1 |
| InChI | InChI=1S/C19H21NO/c1-2-13-21-19-8-4-7-17(15-19)10-9-16-5-3-6-18(14-16)11-12-20/h3-8,14-15H,2,9-11,13H2,1H3 |
| InChIKey | IQHCYKCQGXGXFA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |