C21H15F3IN3O2 — CID 141318663
3-[5-[3-[3-iodo-4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]indol-1-yl]propanoic acid (PubChem CID 141318663) has the molecular formula C21H15F3IN3O2 and a molecular weight of 525.27 g/mol. Its IUPAC name is 3-[5-[3-[3-iodo-4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]indol-1-yl]propanoic acid.
| Compound Name | 3-[5-[3-[3-iodo-4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 141318663 |
| Molecular Formula | C21H15F3IN3O2 |
| Molecular Weight | 525.27 g/mol |
| Exact Mass | 525.02 |
| IUPAC Name | 3-[5-[3-[3-iodo-4-(trifluoromethyl)phenyl]-1H-pyrazol-5-yl]indol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1ccc2cc(-c3cc(-c4ccc(C(F)(F)F)c(I)c4)n[nH]3)ccc21 |
| InChI | InChI=1S/C21H15F3IN3O2/c22-21(23,24)15-3-1-13(10-16(15)25)18-11-17(26-27-18)12-2-4-19-14(9-12)5-7-28(19)8-6-20(29)30/h1-5,7,9-11H,6,8H2,(H,26,27)(H,29,30) |
| InChIKey | RMUBACNLIZRUAS-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.27 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|