About 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one
1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one (PubChem CID 141318848) has the molecular formula C9H15N5O
and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one.
Molecular Properties
| Compound Name | 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one |
| PubChem CID | 141318848 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one |
| SMILES | CCC(=O)N1CCN(c2ncn[nH]2)CC1 |
| InChI | InChI=1S/C9H15N5O/c1-2-8(15)13-3-5-14(6-4-13)9-10-7-11-12-9/h7H,2-6H2,1H3,(H,10,11,12) |
| InChIKey | DJZDCDJQOSCSKS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one?
The IUPAC name of 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one (CID 141318848) is 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one.
What is the SMILES notation for 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one?
The canonical SMILES for 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one is CCC(=O)N1CCN(c2ncn[nH]2)CC1.
What is the InChIKey of 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one?
The InChIKey is DJZDCDJQOSCSKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N5O/c1-2-8(15)13-3-5-14(6-4-13)9-10-7-11-12-9/h7H,2-6H2,1H3,(H,10,11,12).
What are the key properties of 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one?
1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one has a molecular weight of 209.25 g/mol, XLogP of -0.14, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one is sourced from PubChem (CID 141318848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).