C12H22N6O3 — CID 154905343
2-(dimethylamino)-1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one;formic acid (PubChem CID 154905343) has the molecular formula C12H22N6O3 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-(dimethylamino)-1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one;formic acid.
| Compound Name | 2-(dimethylamino)-1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one;formic acid |
|---|---|
| PubChem CID | 154905343 |
| Molecular Formula | C12H22N6O3 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | 2-(dimethylamino)-1-[4-(1H-1,2,4-triazol-5-yl)piperazin-1-yl]propan-1-one;formic acid |
| SMILES | CC(C(=O)N1CCN(c2ncn[nH]2)CC1)N(C)C.O=CO |
| InChI | InChI=1S/C11H20N6O.CH2O2/c1-9(15(2)3)10(18)16-4-6-17(7-5-16)11-12-8-13-14-11;2-1-3/h8-9H,4-7H2,1-3H3,(H,12,13,14);1H,(H,2,3) |
| InChIKey | BQLAXPJDVWXXAR-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|