C19H30N6O6 — CID 171339698
formic acid;oxan-4-yl-[6-[4-(1H-1,2,4-triazol-5-yl)piperazine-1-carbonyl]-1,4-oxazepan-4-yl]methanone (PubChem CID 171339698) has the molecular formula C19H30N6O6 and a molecular weight of 438.49 g/mol. Its IUPAC name is formic acid;oxan-4-yl-[6-[4-(1H-1,2,4-triazol-5-yl)piperazine-1-carbonyl]-1,4-oxazepan-4-yl]methanone.
| Compound Name | formic acid;oxan-4-yl-[6-[4-(1H-1,2,4-triazol-5-yl)piperazine-1-carbonyl]-1,4-oxazepan-4-yl]methanone |
|---|---|
| PubChem CID | 171339698 |
| Molecular Formula | C19H30N6O6 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | formic acid;oxan-4-yl-[6-[4-(1H-1,2,4-triazol-5-yl)piperazine-1-carbonyl]-1,4-oxazepan-4-yl]methanone |
| SMILES | O=C(C1COCCN(C(=O)C2CCOCC2)C1)N1CCN(c2ncn[nH]2)CC1.O=CO |
| InChI | InChI=1S/C18H28N6O4.CH2O2/c25-16(14-1-8-27-9-2-14)24-7-10-28-12-15(11-24)17(26)22-3-5-23(6-4-22)18-19-13-20-21-18;2-1-3/h13-15H,1-12H2,(H,19,20,21);1H,(H,2,3) |
| InChIKey | JGSUQMHBUJRWMU-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 141.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|