C22H47NO2 — CID 141320340
N,N-dimethyl-2,3-dioctoxybutan-2-amine (PubChem CID 141320340) has the molecular formula C22H47NO2 and a molecular weight of 357.62 g/mol. Its IUPAC name is N,N-dimethyl-2,3-dioctoxybutan-2-amine.
| Compound Name | N,N-dimethyl-2,3-dioctoxybutan-2-amine |
|---|---|
| PubChem CID | 141320340 |
| Molecular Formula | C22H47NO2 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 357.36 |
| IUPAC Name | N,N-dimethyl-2,3-dioctoxybutan-2-amine |
| SMILES | CCCCCCCCOC(C)C(C)(OCCCCCCCC)N(C)C |
| InChI | InChI=1S/C22H47NO2/c1-7-9-11-13-15-17-19-24-21(3)22(4,23(5)6)25-20-18-16-14-12-10-8-2/h21H,7-20H2,1-6H3 |
| InChIKey | FLAZGMPEHOGPPN-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|