C17H22N2O4S — CID 141320594
imidazol-1-yloxy-[1-(4-methoxyphenoxy)-3,3-dimethylbutan-2-yl]oxymethanethione (PubChem CID 141320594) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is imidazol-1-yloxy-[1-(4-methoxyphenoxy)-3,3-dimethylbutan-2-yl]oxymethanethione.
| Compound Name | imidazol-1-yloxy-[1-(4-methoxyphenoxy)-3,3-dimethylbutan-2-yl]oxymethanethione |
|---|---|
| PubChem CID | 141320594 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | imidazol-1-yloxy-[1-(4-methoxyphenoxy)-3,3-dimethylbutan-2-yl]oxymethanethione |
| SMILES | COc1ccc(OCC(OC(=S)On2ccnc2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H22N2O4S/c1-17(2,3)15(22-16(24)23-19-10-9-18-12-19)11-21-14-7-5-13(20-4)6-8-14/h5-10,12,15H,11H2,1-4H3 |
| InChIKey | BNQBDYRNGXNZNC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|