C10H20O2Si — CID 141321128
(5,6-dimethyl-3,6-dihydro-2H-pyran-4-yl)oxy-trimethylsilane (PubChem CID 141321128) has the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. Its IUPAC name is (5,6-dimethyl-3,6-dihydro-2H-pyran-4-yl)oxy-trimethylsilane.
| Compound Name | (5,6-dimethyl-3,6-dihydro-2H-pyran-4-yl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 141321128 |
| Molecular Formula | C10H20O2Si |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (5,6-dimethyl-3,6-dihydro-2H-pyran-4-yl)oxy-trimethylsilane |
| SMILES | CC1=C(O[Si](C)(C)C)CCOC1C |
| InChI | InChI=1S/C10H20O2Si/c1-8-9(2)11-7-6-10(8)12-13(3,4)5/h9H,6-7H2,1-5H3 |
| InChIKey | TXAHLYALCCAYFU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|